C33H40F3NO3 — CID 139802609
6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[5-(4-hexylphenyl)-2-pyridinyl]benzoate (PubChem CID 139802609) has the molecular formula C33H40F3NO3 and a molecular weight of 555.68 g/mol. Its IUPAC name is 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[5-(4-hexylphenyl)-2-pyridinyl]benzoate.
| Compound Name | 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[5-(4-hexylphenyl)-2-pyridinyl]benzoate |
|---|---|
| PubChem CID | 139802609 |
| Molecular Formula | C33H40F3NO3 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[5-(4-hexylphenyl)-2-pyridinyl]benzoate |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OCCCCCCOC(C)C(F)(F)F)cc3)nc2)cc1 |
| InChI | InChI=1S/C33H40F3NO3/c1-3-4-5-8-11-26-12-14-27(15-13-26)30-20-21-31(37-24-30)28-16-18-29(19-17-28)32(38)40-23-10-7-6-9-22-39-25(2)33(34,35)36/h12-21,24-25H,3-11,22-23H2,1-2H3 |
| InChIKey | ZYAFWZUTTVFOOJ-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|