C26H34F3NO2 — CID 139786470
3-(trifluoromethyl)nonyl 4-(5-butyl-2-pyridinyl)benzoate (PubChem CID 139786470) has the molecular formula C26H34F3NO2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 3-(trifluoromethyl)nonyl 4-(5-butyl-2-pyridinyl)benzoate.
| Compound Name | 3-(trifluoromethyl)nonyl 4-(5-butyl-2-pyridinyl)benzoate |
|---|---|
| PubChem CID | 139786470 |
| Molecular Formula | C26H34F3NO2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 3-(trifluoromethyl)nonyl 4-(5-butyl-2-pyridinyl)benzoate |
| SMILES | CCCCCCC(CCOC(=O)c1ccc(-c2ccc(CCCC)cn2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H34F3NO2/c1-3-5-7-8-10-23(26(27,28)29)17-18-32-25(31)22-14-12-21(13-15-22)24-16-11-20(19-30-24)9-6-4-2/h11-16,19,23H,3-10,17-18H2,1-2H3 |
| InChIKey | OJHUHSJZHFDYMZ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|