C27H36F3NO2 — CID 139786540
[4-(5-octyl-2-pyridinyl)phenyl] 3-(trifluoromethyl)heptanoate (PubChem CID 139786540) has the molecular formula C27H36F3NO2 and a molecular weight of 463.58 g/mol. Its IUPAC name is [4-(5-octyl-2-pyridinyl)phenyl] 3-(trifluoromethyl)heptanoate.
| Compound Name | [4-(5-octyl-2-pyridinyl)phenyl] 3-(trifluoromethyl)heptanoate |
|---|---|
| PubChem CID | 139786540 |
| Molecular Formula | C27H36F3NO2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | [4-(5-octyl-2-pyridinyl)phenyl] 3-(trifluoromethyl)heptanoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(OC(=O)CC(CCCC)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C27H36F3NO2/c1-3-5-7-8-9-10-11-21-13-18-25(31-20-21)22-14-16-24(17-15-22)33-26(32)19-23(12-6-4-2)27(28,29)30/h13-18,20,23H,3-12,19H2,1-2H3 |
| InChIKey | RIEXSZOHKIHFNR-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|