C33H42ClNO2 — CID 88646410
[4-[4-(5-hexyl-2-pyridinyl)phenyl]phenyl] 2-chloro-3,7-dimethyloctanoate (PubChem CID 88646410) has the molecular formula C33H42ClNO2 and a molecular weight of 520.16 g/mol. Its IUPAC name is [4-[4-(5-hexyl-2-pyridinyl)phenyl]phenyl] 2-chloro-3,7-dimethyloctanoate.
| Compound Name | [4-[4-(5-hexyl-2-pyridinyl)phenyl]phenyl] 2-chloro-3,7-dimethyloctanoate |
|---|---|
| PubChem CID | 88646410 |
| Molecular Formula | C33H42ClNO2 |
| Molecular Weight | 520.16 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | [4-[4-(5-hexyl-2-pyridinyl)phenyl]phenyl] 2-chloro-3,7-dimethyloctanoate |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(OC(=O)C(Cl)C(C)CCCC(C)C)cc3)cc2)nc1 |
| InChI | InChI=1S/C33H42ClNO2/c1-5-6-7-8-12-26-13-22-31(35-23-26)29-16-14-27(15-17-29)28-18-20-30(21-19-28)37-33(36)32(34)25(4)11-9-10-24(2)3/h13-25,32H,5-12H2,1-4H3 |
| InChIKey | AOFCRSXTWQGILL-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.16 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|