C35H48N2O2 — CID 18945846
[4-[5-(4-decylphenyl)pyrimidin-2-yl]phenyl] 2,6-dimethylheptanoate (PubChem CID 18945846) has the molecular formula C35H48N2O2 and a molecular weight of 528.78 g/mol. Its IUPAC name is [4-[5-(4-decylphenyl)pyrimidin-2-yl]phenyl] 2,6-dimethylheptanoate.
| Compound Name | [4-[5-(4-decylphenyl)pyrimidin-2-yl]phenyl] 2,6-dimethylheptanoate |
|---|---|
| PubChem CID | 18945846 |
| Molecular Formula | C35H48N2O2 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | [4-[5-(4-decylphenyl)pyrimidin-2-yl]phenyl] 2,6-dimethylheptanoate |
| SMILES | CCCCCCCCCCc1ccc(-c2cnc(-c3ccc(OC(=O)C(C)CCCC(C)C)cc3)nc2)cc1 |
| InChI | InChI=1S/C35H48N2O2/c1-5-6-7-8-9-10-11-12-16-29-17-19-30(20-18-29)32-25-36-34(37-26-32)31-21-23-33(24-22-31)39-35(38)28(4)15-13-14-27(2)3/h17-28H,5-16H2,1-4H3 |
| InChIKey | PQLPUSKAJVWICA-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|