About [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate
[4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate (PubChem CID 15745208) has the molecular formula C29H36N2O3
and a molecular weight of 460.62 g/mol. Its IUPAC name is [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate.
Molecular Properties
| Compound Name | [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate |
| PubChem CID | 15745208 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate |
| SMILES | CCCCCCOc1ccc(-c2ncc(-c3ccc(OC(=O)C(C)CCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C29H36N2O3/c1-4-6-8-9-19-33-26-15-13-24(14-16-26)28-30-20-25(21-31-28)23-11-17-27(18-12-23)34-29(32)22(3)10-7-5-2/h11-18,20-22H,4-10,19H2,1-3H3 |
| InChIKey | FZZMBEBTGQXBBS-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate?
The IUPAC name of [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate (CID 15745208) is [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate.
What is the SMILES notation for [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate?
The canonical SMILES for [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate is CCCCCCOc1ccc(-c2ncc(-c3ccc(OC(=O)C(C)CCCC)cc3)cn2)cc1.
What is the InChIKey of [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate?
The InChIKey is FZZMBEBTGQXBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H36N2O3/c1-4-6-8-9-19-33-26-15-13-24(14-16-26)28-30-20-25(21-31-28)23-11-17-27(18-12-23)34-29(32)22(3)10-7-5-2/h11-18,20-22H,4-10,19H2,1-3H3.
What are the key properties of [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate?
[4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate has a molecular weight of 460.62 g/mol, XLogP of 7.50, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-methylhexanoate is sourced from PubChem (CID 15745208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).