C38H53ClN2O4 — CID 70423138
[4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] (2R)-3-(3-chlorooctoxy)-2-methylpropanoate (PubChem CID 70423138) has the molecular formula C38H53ClN2O4 and a molecular weight of 637.31 g/mol. Its IUPAC name is [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] (2R)-3-(3-chlorooctoxy)-2-methylpropanoate.
| Compound Name | [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] (2R)-3-(3-chlorooctoxy)-2-methylpropanoate |
|---|---|
| PubChem CID | 70423138 |
| Molecular Formula | C38H53ClN2O4 |
| Molecular Weight | 637.31 g/mol |
| Exact Mass | 636.37 |
| IUPAC Name | [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] (2R)-3-(3-chlorooctoxy)-2-methylpropanoate |
| SMILES | CCCCCCCCCCOc1cnc(-c2ccc(-c3ccc(OC(=O)[C@H](C)COCCC(Cl)CCCCC)cc3)cc2)nc1 |
| InChI | InChI=1S/C38H53ClN2O4/c1-4-6-8-9-10-11-12-14-25-44-36-27-40-37(41-28-36)33-18-16-31(17-19-33)32-20-22-35(23-21-32)45-38(42)30(3)29-43-26-24-34(39)15-13-7-5-2/h16-23,27-28,30,34H,4-15,24-26,29H2,1-3H3/t30-,34?/m1/s1 |
| InChIKey | USHZCINAMYOJQA-AMLLJQFGSA-N |
| XLogP | 10.47 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.31 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|