C27H40N2O3 — CID 19742429
[4-(5-nonylpyrimidin-2-yl)phenyl] 3-butoxy-2-methylpropanoate (PubChem CID 19742429) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is [4-(5-nonylpyrimidin-2-yl)phenyl] 3-butoxy-2-methylpropanoate.
| Compound Name | [4-(5-nonylpyrimidin-2-yl)phenyl] 3-butoxy-2-methylpropanoate |
|---|---|
| PubChem CID | 19742429 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | [4-(5-nonylpyrimidin-2-yl)phenyl] 3-butoxy-2-methylpropanoate |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(OC(=O)C(C)COCCCC)cc2)nc1 |
| InChI | InChI=1S/C27H40N2O3/c1-4-6-8-9-10-11-12-13-23-19-28-26(29-20-23)24-14-16-25(17-15-24)32-27(30)22(3)21-31-18-7-5-2/h14-17,19-20,22H,4-13,18,21H2,1-3H3 |
| InChIKey | KZYIRUFHWXUUAL-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|