C23H31ClN2O2 — CID 139882425
[4-(5-heptylpyrimidin-2-yl)phenyl] 2-chloro-3,3-dimethylbutanoate (PubChem CID 139882425) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is [4-(5-heptylpyrimidin-2-yl)phenyl] 2-chloro-3,3-dimethylbutanoate.
| Compound Name | [4-(5-heptylpyrimidin-2-yl)phenyl] 2-chloro-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 139882425 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | [4-(5-heptylpyrimidin-2-yl)phenyl] 2-chloro-3,3-dimethylbutanoate |
| SMILES | CCCCCCCc1cnc(-c2ccc(OC(=O)C(Cl)C(C)(C)C)cc2)nc1 |
| InChI | InChI=1S/C23H31ClN2O2/c1-5-6-7-8-9-10-17-15-25-21(26-16-17)18-11-13-19(14-12-18)28-22(27)20(24)23(2,3)4/h11-16,20H,5-10H2,1-4H3 |
| InChIKey | CCIFRQFCWILISL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|