About [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate
[4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate (PubChem CID 19807814) has the molecular formula C28H42N2O3
and a molecular weight of 454.66 g/mol. Its IUPAC name is [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate.
Molecular Properties
| Compound Name | [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate |
| PubChem CID | 19807814 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(OC(=O)CCOCCCCC)cc2)nc1 |
| InChI | InChI=1S/C28H42N2O3/c1-3-5-7-8-9-10-11-12-14-24-22-29-28(30-23-24)25-15-17-26(18-16-25)33-27(31)19-21-32-20-13-6-4-2/h15-18,22-23H,3-14,19-21H2,1-2H3 |
| InChIKey | JKCUSGJGOQVZDS-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate?
The IUPAC name of [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate (CID 19807814) is [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate.
What is the SMILES notation for [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate?
The canonical SMILES for [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate is CCCCCCCCCCc1cnc(-c2ccc(OC(=O)CCOCCCCC)cc2)nc1.
What is the InChIKey of [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate?
The InChIKey is JKCUSGJGOQVZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H42N2O3/c1-3-5-7-8-9-10-11-12-14-24-22-29-28(30-23-24)25-15-17-26(18-16-25)33-27(31)19-21-32-20-13-6-4-2/h15-18,22-23H,3-14,19-21H2,1-2H3.
What are the key properties of [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate?
[4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate has a molecular weight of 454.66 g/mol, XLogP of 7.33, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-decylpyrimidin-2-yl)phenyl] 3-pentoxypropanoate is sourced from PubChem (CID 19807814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).