About [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate
[4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate (PubChem CID 19083607) has the molecular formula C31H46N2O2
and a molecular weight of 478.72 g/mol. Its IUPAC name is [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate.
Molecular Properties
| Compound Name | [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate |
| PubChem CID | 19083607 |
| Molecular Formula | C31H46N2O2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(OC(=O)CCCCCCC3CCCC3)cc2)nc1 |
| InChI | InChI=1S/C31H46N2O2/c1-2-3-4-5-6-7-11-18-27-24-32-31(33-25-27)28-20-22-29(23-21-28)35-30(34)19-12-9-8-10-15-26-16-13-14-17-26/h20-26H,2-19H2,1H3 |
| InChIKey | WRHGUFFHNLLOOE-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate?
The IUPAC name of [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate (CID 19083607) is [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate.
What is the SMILES notation for [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate?
The canonical SMILES for [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate is CCCCCCCCCc1cnc(-c2ccc(OC(=O)CCCCCCC3CCCC3)cc2)nc1.
What is the InChIKey of [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate?
The InChIKey is WRHGUFFHNLLOOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H46N2O2/c1-2-3-4-5-6-7-11-18-27-24-32-31(33-25-27)28-20-22-29(23-21-28)35-30(34)19-12-9-8-10-15-26-16-13-14-17-26/h20-26H,2-19H2,1H3.
What are the key properties of [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate?
[4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate has a molecular weight of 478.72 g/mol, XLogP of 8.87, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-nonylpyrimidin-2-yl)phenyl] 7-cyclopentylheptanoate is sourced from PubChem (CID 19083607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).