C28H38N2O2 — CID 177438100
[4-(5-octylpyrimidin-2-yl)phenyl] 4-[(1R,2S)-2-cyclopropylcyclopropyl]butanoate (PubChem CID 177438100) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is [4-(5-octylpyrimidin-2-yl)phenyl] 4-[(1R,2S)-2-cyclopropylcyclopropyl]butanoate.
| Compound Name | [4-(5-octylpyrimidin-2-yl)phenyl] 4-[(1R,2S)-2-cyclopropylcyclopropyl]butanoate |
|---|---|
| PubChem CID | 177438100 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | [4-(5-octylpyrimidin-2-yl)phenyl] 4-[(1R,2S)-2-cyclopropylcyclopropyl]butanoate |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC(=O)CCC[C@@H]3C[C@@H]3C3CC3)cc2)nc1 |
| InChI | InChI=1S/C28H38N2O2/c1-2-3-4-5-6-7-9-21-19-29-28(30-20-21)23-14-16-25(17-15-23)32-27(31)11-8-10-24-18-26(24)22-12-13-22/h14-17,19-20,22,24,26H,2-13,18H2,1H3/t24-,26-/m1/s1 |
| InChIKey | HZOGXPISSDOCMO-AOYPEHQESA-N |
| XLogP | 7.17 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|