About [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate
[4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate (PubChem CID 19083460) has the molecular formula C36H48N2O2
and a molecular weight of 540.79 g/mol. Its IUPAC name is [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate.
Molecular Properties
| Compound Name | [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate |
| PubChem CID | 19083460 |
| Molecular Formula | C36H48N2O2 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate |
| SMILES | CCCCCc1cnc(-c2ccc(-c3ccc(OC(=O)CCCCCCCCCC4CCCC4)cc3)cc2)nc1 |
| InChI | InChI=1S/C36H48N2O2/c1-2-3-9-17-30-27-37-36(38-28-30)33-21-19-31(20-22-33)32-23-25-34(26-24-32)40-35(39)18-11-8-6-4-5-7-10-14-29-15-12-13-16-29/h19-29H,2-18H2,1H3 |
| InChIKey | MNWOCUATBDNIDD-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate?
The IUPAC name of [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate (CID 19083460) is [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate.
What is the SMILES notation for [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate?
The canonical SMILES for [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate is CCCCCc1cnc(-c2ccc(-c3ccc(OC(=O)CCCCCCCCCC4CCCC4)cc3)cc2)nc1.
What is the InChIKey of [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate?
The InChIKey is MNWOCUATBDNIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H48N2O2/c1-2-3-9-17-30-27-37-36(38-28-30)33-21-19-31(20-22-33)32-23-25-34(26-24-32)40-35(39)18-11-8-6-4-5-7-10-14-29-15-12-13-16-29/h19-29H,2-18H2,1H3.
What are the key properties of [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate?
[4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate has a molecular weight of 540.79 g/mol, XLogP of 10.15, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(5-pentylpyrimidin-2-yl)phenyl]phenyl] 10-cyclopentyldecanoate is sourced from PubChem (CID 19083460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).