About [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate
[4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate (PubChem CID 19891581) has the molecular formula C22H30N2O3
and a molecular weight of 370.49 g/mol. Its IUPAC name is [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate.
Molecular Properties
| Compound Name | [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate |
| PubChem CID | 19891581 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate |
| SMILES | CCCCCCCc1cnc(-c2ccc(OOC(=O)CCCC)cc2)nc1 |
| InChI | InChI=1S/C22H30N2O3/c1-3-5-7-8-9-10-18-16-23-22(24-17-18)19-12-14-20(15-13-19)26-27-21(25)11-6-4-2/h12-17H,3-11H2,1-2H3 |
| InChIKey | URKBTEIZEQWBBT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate?
The IUPAC name of [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate (CID 19891581) is [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate.
What is the SMILES notation for [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate?
The canonical SMILES for [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate is CCCCCCCc1cnc(-c2ccc(OOC(=O)CCCC)cc2)nc1.
What is the InChIKey of [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate?
The InChIKey is URKBTEIZEQWBBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O3/c1-3-5-7-8-9-10-18-16-23-22(24-17-18)19-12-14-20(15-13-19)26-27-21(25)11-6-4-2/h12-17H,3-11H2,1-2H3.
What are the key properties of [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate?
[4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate has a molecular weight of 370.49 g/mol, XLogP of 5.68, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-heptylpyrimidin-2-yl)phenyl] pentaneperoxoate is sourced from PubChem (CID 19891581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).