C54H66N4O4 — CID 177473133
5-octyl-2-[4-[3-[4-[4-[3-[4-(5-octylpyrimidin-2-yl)phenoxy]propoxy]phenyl]phenoxy]propoxy]phenyl]pyrimidine (PubChem CID 177473133) has the molecular formula C54H66N4O4 and a molecular weight of 835.15 g/mol. Its IUPAC name is 5-octyl-2-[4-[3-[4-[4-[3-[4-(5-octylpyrimidin-2-yl)phenoxy]propoxy]phenyl]phenoxy]propoxy]phenyl]pyrimidine.
| Compound Name | 5-octyl-2-[4-[3-[4-[4-[3-[4-(5-octylpyrimidin-2-yl)phenoxy]propoxy]phenyl]phenoxy]propoxy]phenyl]pyrimidine |
|---|---|
| PubChem CID | 177473133 |
| Molecular Formula | C54H66N4O4 |
| Molecular Weight | 835.15 g/mol |
| Exact Mass | 834.51 |
| IUPAC Name | 5-octyl-2-[4-[3-[4-[4-[3-[4-(5-octylpyrimidin-2-yl)phenoxy]propoxy]phenyl]phenoxy]propoxy]phenyl]pyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OCCCOc3ccc(-c4ccc(OCCCOc5ccc(-c6ncc(CCCCCCCC)cn6)cc5)cc4)cc3)cc2)nc1 |
| InChI | InChI=1S/C54H66N4O4/c1-3-5-7-9-11-13-17-43-39-55-53(56-40-43)47-23-31-51(32-24-47)61-37-15-35-59-49-27-19-45(20-28-49)46-21-29-50(30-22-46)60-36-16-38-62-52-33-25-48(26-34-52)54-57-41-44(42-58-54)18-14-12-10-8-6-4-2/h19-34,39-42H,3-18,35-38H2,1-2H3 |
| InChIKey | ILYRQFYTPPXRTN-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.15 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|