C31H50N2O — CID 158056138
butane;but-1-ene;5-octyl-2-(4-pent-4-enoxyphenyl)pyrimidine (PubChem CID 158056138) has the molecular formula C31H50N2O and a molecular weight of 466.75 g/mol. Its IUPAC name is butane;but-1-ene;5-octyl-2-(4-pent-4-enoxyphenyl)pyrimidine.
| Compound Name | butane;but-1-ene;5-octyl-2-(4-pent-4-enoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 158056138 |
| Molecular Formula | C31H50N2O |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.39 |
| IUPAC Name | butane;but-1-ene;5-octyl-2-(4-pent-4-enoxyphenyl)pyrimidine |
| SMILES | C=CCC.C=CCCCOc1ccc(-c2ncc(CCCCCCCC)cn2)cc1.CCCC |
| InChI | InChI=1S/C23H32N2O.C4H10.C4H8/c1-3-5-7-8-9-10-12-20-18-24-23(25-19-20)21-13-15-22(16-14-21)26-17-11-6-4-2;2*1-3-4-2/h4,13-16,18-19H,2-3,5-12,17H2,1H3;3-4H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | FKBQDIDFKVYXPV-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|