About [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate
[4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate (PubChem CID 54411583) has the molecular formula C31H38N2O3
and a molecular weight of 486.66 g/mol. Its IUPAC name is [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate.
Molecular Properties
| Compound Name | [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate |
| PubChem CID | 54411583 |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate |
| SMILES | C=CCCCCOc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCCCC)cn3)cc2)cc1 |
| InChI | InChI=1S/C31H38N2O3/c1-3-5-7-9-10-11-13-25-23-32-30(33-24-25)26-14-20-29(21-15-26)36-31(34)27-16-18-28(19-17-27)35-22-12-8-6-4-2/h4,14-21,23-24H,2-3,5-13,22H2,1H3 |
| InChIKey | VUNAMBJBBRCMPJ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate?
The IUPAC name of [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate (CID 54411583) is [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate.
What is the SMILES notation for [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate?
The canonical SMILES for [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate is C=CCCCCOc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCCCC)cn3)cc2)cc1.
What is the InChIKey of [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate?
The InChIKey is VUNAMBJBBRCMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H38N2O3/c1-3-5-7-9-10-11-13-25-23-32-30(33-24-25)26-14-20-29(21-15-26)36-31(34)27-16-18-28(19-17-27)35-22-12-8-6-4-2/h4,14-21,23-24H,2-3,5-13,22H2,1H3.
What are the key properties of [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate?
[4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate has a molecular weight of 486.66 g/mol, XLogP of 8.00, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-octylpyrimidin-2-yl)phenyl] 4-hex-5-enoxybenzoate is sourced from PubChem (CID 54411583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).