About (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate
(4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate (PubChem CID 54389192) has the molecular formula C22H19FN2O2
and a molecular weight of 362.40 g/mol. Its IUPAC name is (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate.
Molecular Properties
| Compound Name | (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate |
| PubChem CID | 54389192 |
| Molecular Formula | C22H19FN2O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate |
| SMILES | C=CCCCc1cnc(-c2ccc(C(=O)Oc3ccc(F)cc3)cc2)nc1 |
| InChI | InChI=1S/C22H19FN2O2/c1-2-3-4-5-16-14-24-21(25-15-16)17-6-8-18(9-7-17)22(26)27-20-12-10-19(23)11-13-20/h2,6-15H,1,3-5H2 |
| InChIKey | VFKQROCMHSRCPD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate?
The IUPAC name of (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate (CID 54389192) is (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate.
What is the SMILES notation for (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate?
The canonical SMILES for (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate is C=CCCCc1cnc(-c2ccc(C(=O)Oc3ccc(F)cc3)cc2)nc1.
What is the InChIKey of (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate?
The InChIKey is VFKQROCMHSRCPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN2O2/c1-2-3-4-5-16-14-24-21(25-15-16)17-6-8-18(9-7-17)22(26)27-20-12-10-19(23)11-13-20/h2,6-15H,1,3-5H2.
What are the key properties of (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate?
(4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate has a molecular weight of 362.40 g/mol, XLogP of 5.01, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate is sourced from PubChem (CID 54389192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).