(4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate

C22H19FN2O2 — CID 54389192

IUPAC(4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate
SMILESC=CCCCc1cnc(-c2ccc(C(=O)Oc3ccc(F)cc3)cc2)nc1
InChIInChI=1S/C22H19FN2O2/c1-2-3-4-5-16-14-24-21(25-15-16)17-6-8-18(9-7-17)22(26)27-20-12-10-19(23)11-13-20/h2,6-15H,1,3-5H2
InChIKeyVFKQROCMHSRCPD-UHFFFAOYSA-N
MW362.40 g/mol
LogP5.01
Rot. Bonds7

About (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate

(4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate (PubChem CID 54389192) has the molecular formula C22H19FN2O2 and a molecular weight of 362.40 g/mol. Its IUPAC name is (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate.

Molecular Properties

Compound Name(4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate
PubChem CID54389192
Molecular FormulaC22H19FN2O2
Molecular Weight362.40 g/mol
Exact Mass362.14
IUPAC Name(4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate
SMILESC=CCCCc1cnc(-c2ccc(C(=O)Oc3ccc(F)cc3)cc2)nc1
InChIInChI=1S/C22H19FN2O2/c1-2-3-4-5-16-14-24-21(25-15-16)17-6-8-18(9-7-17)22(26)27-20-12-10-19(23)11-13-20/h2,6-15H,1,3-5H2
InChIKeyVFKQROCMHSRCPD-UHFFFAOYSA-N
XLogP5.01
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500362.40
LogP ≤ 55.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate?
The IUPAC name of (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate (CID 54389192) is (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate.
What is the SMILES notation for (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate?
The canonical SMILES for (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate is C=CCCCc1cnc(-c2ccc(C(=O)Oc3ccc(F)cc3)cc2)nc1.
What is the InChIKey of (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate?
The InChIKey is VFKQROCMHSRCPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN2O2/c1-2-3-4-5-16-14-24-21(25-15-16)17-6-8-18(9-7-17)22(26)27-20-12-10-19(23)11-13-20/h2,6-15H,1,3-5H2.
What are the key properties of (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate?
(4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate has a molecular weight of 362.40 g/mol, XLogP of 5.01, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) 4-(5-pent-4-enylpyrimidin-2-yl)benzoate is sourced from PubChem (CID 54389192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).