C29H35ClN2O2 — CID 57270745
[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl] (2S,3S)-2-chloro-3-methylpentanoate (PubChem CID 57270745) has the molecular formula C29H35ClN2O2 and a molecular weight of 479.06 g/mol. Its IUPAC name is [2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl] (2S,3S)-2-chloro-3-methylpentanoate.
| Compound Name | [2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl] (2S,3S)-2-chloro-3-methylpentanoate |
|---|---|
| PubChem CID | 57270745 |
| Molecular Formula | C29H35ClN2O2 |
| Molecular Weight | 479.06 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl] (2S,3S)-2-chloro-3-methylpentanoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(-c3ncc(OC(=O)[C@@H](Cl)[C@@H](C)CC)cn3)cc2)cc1 |
| InChI | InChI=1S/C29H35ClN2O2/c1-4-6-7-8-9-10-22-11-13-23(14-12-22)24-15-17-25(18-16-24)28-31-19-26(20-32-28)34-29(33)27(30)21(3)5-2/h11-21,27H,4-10H2,1-3H3/t21-,27-/m0/s1 |
| InChIKey | OYOGDVRXUVSGPN-IDISGSTGSA-N |
| XLogP | 7.88 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.06 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|