About [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate
[2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate (PubChem CID 18647361) has the molecular formula C33H44N2O2
and a molecular weight of 500.73 g/mol. Its IUPAC name is [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate.
Molecular Properties
| Compound Name | [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate |
| PubChem CID | 18647361 |
| Molecular Formula | C33H44N2O2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(-c3ncc(OC(=O)CCCC[C@H](C)CC)cn3)cc2)cc1 |
| InChI | InChI=1S/C33H44N2O2/c1-4-6-7-8-9-10-14-27-16-18-28(19-17-27)29-20-22-30(23-21-29)33-34-24-31(25-35-33)37-32(36)15-12-11-13-26(3)5-2/h16-26H,4-15H2,1-3H3/t26-/m1/s1 |
| InChIKey | AAALGOZMBFQNIU-AREMUKBSSA-N |
| XLogP | 9.23 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate?
The IUPAC name of [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate (CID 18647361) is [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate.
What is the SMILES notation for [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate?
The canonical SMILES for [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate is CCCCCCCCc1ccc(-c2ccc(-c3ncc(OC(=O)CCCC[C@H](C)CC)cn3)cc2)cc1.
What is the InChIKey of [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate?
The InChIKey is AAALGOZMBFQNIU-AREMUKBSSA-N. The full InChI is InChI=1S/C33H44N2O2/c1-4-6-7-8-9-10-14-27-16-18-28(19-17-27)29-20-22-30(23-21-29)33-34-24-31(25-35-33)37-32(36)15-12-11-13-26(3)5-2/h16-26H,4-15H2,1-3H3/t26-/m1/s1.
What are the key properties of [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate?
[2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate has a molecular weight of 500.73 g/mol, XLogP of 9.23, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(4-octylphenyl)phenyl]pyrimidin-5-yl] (6R)-6-methyloctanoate is sourced from PubChem (CID 18647361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).