About [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate
[4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate (PubChem CID 19866265) has the molecular formula C33H44N2O2
and a molecular weight of 500.73 g/mol. Its IUPAC name is [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate.
Molecular Properties
| Compound Name | [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate |
| PubChem CID | 19866265 |
| Molecular Formula | C33H44N2O2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate |
| SMILES | CCCCCCCc1ccc(-c2ncc(-c3ccc(OC(=O)CCCCC(C)CCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C33H44N2O2/c1-4-6-7-8-9-14-27-16-18-29(19-17-27)33-34-24-30(25-35-33)28-20-22-31(23-21-28)37-32(36)15-11-10-13-26(3)12-5-2/h16-26H,4-15H2,1-3H3 |
| InChIKey | FLLRGGDXADXGHL-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate?
The IUPAC name of [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate (CID 19866265) is [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate.
What is the SMILES notation for [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate?
The canonical SMILES for [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate is CCCCCCCc1ccc(-c2ncc(-c3ccc(OC(=O)CCCCC(C)CCC)cc3)cn2)cc1.
What is the InChIKey of [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate?
The InChIKey is FLLRGGDXADXGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H44N2O2/c1-4-6-7-8-9-14-27-16-18-29(19-17-27)33-34-24-30(25-35-33)28-20-22-31(23-21-28)37-32(36)15-11-10-13-26(3)12-5-2/h16-26H,4-15H2,1-3H3.
What are the key properties of [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate?
[4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate has a molecular weight of 500.73 g/mol, XLogP of 9.23, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenyl] 6-methylnonanoate is sourced from PubChem (CID 19866265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).