About [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate
[4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate (PubChem CID 19866276) has the molecular formula C32H42N2O2
and a molecular weight of 486.70 g/mol. Its IUPAC name is [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate.
Molecular Properties
| Compound Name | [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate |
| PubChem CID | 19866276 |
| Molecular Formula | C32H42N2O2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate |
| SMILES | CCCCCCCCCc1ccc(-c2ncc(-c3ccc(OC(=O)CC(C)CCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C32H42N2O2/c1-4-6-7-8-9-10-11-13-26-14-16-28(17-15-26)32-33-23-29(24-34-32)27-18-20-30(21-19-27)36-31(35)22-25(3)12-5-2/h14-21,23-25H,4-13,22H2,1-3H3 |
| InChIKey | YXAAFCBKUKUVIE-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate?
The IUPAC name of [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate (CID 19866276) is [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate.
What is the SMILES notation for [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate?
The canonical SMILES for [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate is CCCCCCCCCc1ccc(-c2ncc(-c3ccc(OC(=O)CC(C)CCC)cc3)cn2)cc1.
What is the InChIKey of [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate?
The InChIKey is YXAAFCBKUKUVIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H42N2O2/c1-4-6-7-8-9-10-11-13-26-14-16-28(17-15-26)32-33-23-29(24-34-32)27-18-20-30(21-19-27)36-31(35)22-25(3)12-5-2/h14-21,23-25H,4-13,22H2,1-3H3.
What are the key properties of [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate?
[4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate has a molecular weight of 486.70 g/mol, XLogP of 8.84, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenyl] 3-methylhexanoate is sourced from PubChem (CID 19866276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).