C31H40N2O3 — CID 19866173
1-[4-[5-(4-pentylphenyl)pyrimidin-2-yl]phenoxy]propan-2-yl 3-methylhexanoate (PubChem CID 19866173) has the molecular formula C31H40N2O3 and a molecular weight of 488.67 g/mol. Its IUPAC name is 1-[4-[5-(4-pentylphenyl)pyrimidin-2-yl]phenoxy]propan-2-yl 3-methylhexanoate.
| Compound Name | 1-[4-[5-(4-pentylphenyl)pyrimidin-2-yl]phenoxy]propan-2-yl 3-methylhexanoate |
|---|---|
| PubChem CID | 19866173 |
| Molecular Formula | C31H40N2O3 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 1-[4-[5-(4-pentylphenyl)pyrimidin-2-yl]phenoxy]propan-2-yl 3-methylhexanoate |
| SMILES | CCCCCc1ccc(-c2cnc(-c3ccc(OCC(C)OC(=O)CC(C)CCC)cc3)nc2)cc1 |
| InChI | InChI=1S/C31H40N2O3/c1-5-7-8-10-25-11-13-26(14-12-25)28-20-32-31(33-21-28)27-15-17-29(18-16-27)35-22-24(4)36-30(34)19-23(3)9-6-2/h11-18,20-21,23-24H,5-10,19,22H2,1-4H3 |
| InChIKey | PDMVJYAOJCIVTM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|