C33H44N2O3 — CID 14766686
1-[4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-methylbutanoate (PubChem CID 14766686) has the molecular formula C33H44N2O3 and a molecular weight of 516.73 g/mol. Its IUPAC name is 1-[4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-methylbutanoate.
| Compound Name | 1-[4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-methylbutanoate |
|---|---|
| PubChem CID | 14766686 |
| Molecular Formula | C33H44N2O3 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | 1-[4-[2-(4-nonylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-methylbutanoate |
| SMILES | CCCCCCCCCc1ccc(-c2ncc(-c3ccc(OCC(C)OC(=O)C(C)CC)cc3)cn2)cc1 |
| InChI | InChI=1S/C33H44N2O3/c1-5-7-8-9-10-11-12-13-27-14-16-29(17-15-27)32-34-22-30(23-35-32)28-18-20-31(21-19-28)37-24-26(4)38-33(36)25(3)6-2/h14-23,25-26H,5-13,24H2,1-4H3 |
| InChIKey | FJSCFUAKBBLIAF-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|