C31H41FN2O — CID 22161083
5-[4-(2-fluoro-3-methylpentoxy)phenyl]-2-(4-nonylphenyl)pyrimidine (PubChem CID 22161083) has the molecular formula C31H41FN2O and a molecular weight of 476.68 g/mol. Its IUPAC name is 5-[4-(2-fluoro-3-methylpentoxy)phenyl]-2-(4-nonylphenyl)pyrimidine.
| Compound Name | 5-[4-(2-fluoro-3-methylpentoxy)phenyl]-2-(4-nonylphenyl)pyrimidine |
|---|---|
| PubChem CID | 22161083 |
| Molecular Formula | C31H41FN2O |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 5-[4-(2-fluoro-3-methylpentoxy)phenyl]-2-(4-nonylphenyl)pyrimidine |
| SMILES | CCCCCCCCCc1ccc(-c2ncc(-c3ccc(OCC(F)C(C)CC)cc3)cn2)cc1 |
| InChI | InChI=1S/C31H41FN2O/c1-4-6-7-8-9-10-11-12-25-13-15-27(16-14-25)31-33-21-28(22-34-31)26-17-19-29(20-18-26)35-23-30(32)24(3)5-2/h13-22,24,30H,4-12,23H2,1-3H3 |
| InChIKey | ZMSVCSXNZLMWGA-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|