C29H36F2N2O — CID 139670464
5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-(4-heptylphenyl)pyrimidine (PubChem CID 139670464) has the molecular formula C29H36F2N2O and a molecular weight of 466.62 g/mol. Its IUPAC name is 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-(4-heptylphenyl)pyrimidine.
| Compound Name | 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-(4-heptylphenyl)pyrimidine |
|---|---|
| PubChem CID | 139670464 |
| Molecular Formula | C29H36F2N2O |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-(4-heptylphenyl)pyrimidine |
| SMILES | CCCCCCCc1ccc(-c2ncc(-c3ccc(OC[C@@H](F)[C@H](F)CCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C29H36F2N2O/c1-3-5-6-7-8-10-22-11-13-24(14-12-22)29-32-19-25(20-33-29)23-15-17-26(18-16-23)34-21-28(31)27(30)9-4-2/h11-20,27-28H,3-10,21H2,1-2H3/t27-,28-/m1/s1 |
| InChIKey | NSUWXXUHHNFEJA-VSGBNLITSA-N |
| XLogP | 8.18 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|