C28H42F2N2O — CID 18697117
2-(4-decylphenyl)-5-(2,3-difluorooctoxy)pyrimidine (PubChem CID 18697117) has the molecular formula C28H42F2N2O and a molecular weight of 460.65 g/mol. Its IUPAC name is 2-(4-decylphenyl)-5-(2,3-difluorooctoxy)pyrimidine.
| Compound Name | 2-(4-decylphenyl)-5-(2,3-difluorooctoxy)pyrimidine |
|---|---|
| PubChem CID | 18697117 |
| Molecular Formula | C28H42F2N2O |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | 2-(4-decylphenyl)-5-(2,3-difluorooctoxy)pyrimidine |
| SMILES | CCCCCCCCCCc1ccc(-c2ncc(OCC(F)C(F)CCCCC)cn2)cc1 |
| InChI | InChI=1S/C28H42F2N2O/c1-3-5-7-8-9-10-11-13-14-23-16-18-24(19-17-23)28-31-20-25(21-32-28)33-22-27(30)26(29)15-12-6-4-2/h16-21,26-27H,3-15,22H2,1-2H3 |
| InChIKey | OQNIMHFFFARJMD-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|