C30H38F2N2O — CID 139670467
5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-(4-octylphenyl)pyrimidine (PubChem CID 139670467) has the molecular formula C30H38F2N2O and a molecular weight of 480.64 g/mol. Its IUPAC name is 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-(4-octylphenyl)pyrimidine.
| Compound Name | 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-(4-octylphenyl)pyrimidine |
|---|---|
| PubChem CID | 139670467 |
| Molecular Formula | C30H38F2N2O |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-(4-octylphenyl)pyrimidine |
| SMILES | CCCCCCCCc1ccc(-c2ncc(-c3ccc(OC[C@@H](F)[C@H](F)CCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C30H38F2N2O/c1-3-5-6-7-8-9-11-23-12-14-25(15-13-23)30-33-20-26(21-34-30)24-16-18-27(19-17-24)35-22-29(32)28(31)10-4-2/h12-21,28-29H,3-11,22H2,1-2H3/t28-,29-/m1/s1 |
| InChIKey | KAKHNOCRCFYKIX-FQLXRVMXSA-N |
| XLogP | 8.57 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|