C29H37FN2O — CID 22161202
5-[4-(2-fluoro-4-methylpentoxy)phenyl]-2-(4-heptylphenyl)pyrimidine (PubChem CID 22161202) has the molecular formula C29H37FN2O and a molecular weight of 448.63 g/mol. Its IUPAC name is 5-[4-(2-fluoro-4-methylpentoxy)phenyl]-2-(4-heptylphenyl)pyrimidine.
| Compound Name | 5-[4-(2-fluoro-4-methylpentoxy)phenyl]-2-(4-heptylphenyl)pyrimidine |
|---|---|
| PubChem CID | 22161202 |
| Molecular Formula | C29H37FN2O |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 5-[4-(2-fluoro-4-methylpentoxy)phenyl]-2-(4-heptylphenyl)pyrimidine |
| SMILES | CCCCCCCc1ccc(-c2ncc(-c3ccc(OCC(F)CC(C)C)cc3)cn2)cc1 |
| InChI | InChI=1S/C29H37FN2O/c1-4-5-6-7-8-9-23-10-12-25(13-11-23)29-31-19-26(20-32-29)24-14-16-28(17-15-24)33-21-27(30)18-22(2)3/h10-17,19-20,22,27H,4-9,18,21H2,1-3H3 |
| InChIKey | MMQUCUSCPJEUKE-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|