C29H37FN2O2 — CID 54563076
2-[4-(2-fluoro-4-methylpentoxy)phenyl]-5-(4-heptoxyphenyl)pyrimidine (PubChem CID 54563076) has the molecular formula C29H37FN2O2 and a molecular weight of 464.63 g/mol. Its IUPAC name is 2-[4-(2-fluoro-4-methylpentoxy)phenyl]-5-(4-heptoxyphenyl)pyrimidine.
| Compound Name | 2-[4-(2-fluoro-4-methylpentoxy)phenyl]-5-(4-heptoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 54563076 |
| Molecular Formula | C29H37FN2O2 |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 2-[4-(2-fluoro-4-methylpentoxy)phenyl]-5-(4-heptoxyphenyl)pyrimidine |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(OCC(F)CC(C)C)cc3)nc2)cc1 |
| InChI | InChI=1S/C29H37FN2O2/c1-4-5-6-7-8-17-33-27-13-9-23(10-14-27)25-19-31-29(32-20-25)24-11-15-28(16-12-24)34-21-26(30)18-22(2)3/h9-16,19-20,22,26H,4-8,17-18,21H2,1-3H3 |
| InChIKey | ZRXATFAFVIHGKE-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|