C28H36N2O3 — CID 19866116
2-(4-hexoxyphenyl)-5-[4-(2-propoxypropoxy)phenyl]pyrimidine (PubChem CID 19866116) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-(4-hexoxyphenyl)-5-[4-(2-propoxypropoxy)phenyl]pyrimidine.
| Compound Name | 2-(4-hexoxyphenyl)-5-[4-(2-propoxypropoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 19866116 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 2-(4-hexoxyphenyl)-5-[4-(2-propoxypropoxy)phenyl]pyrimidine |
| SMILES | CCCCCCOc1ccc(-c2ncc(-c3ccc(OCC(C)OCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C28H36N2O3/c1-4-6-7-8-18-32-26-15-11-24(12-16-26)28-29-19-25(20-30-28)23-9-13-27(14-10-23)33-21-22(3)31-17-5-2/h9-16,19-20,22H,4-8,17-18,21H2,1-3H3 |
| InChIKey | VNQSRBJORDLHQJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|