C30H39FN2O2 — CID 54220564
2-[4-(2-fluoro-4-methylpentoxy)phenyl]-5-(4-octoxyphenyl)pyrimidine (PubChem CID 54220564) has the molecular formula C30H39FN2O2 and a molecular weight of 478.65 g/mol. Its IUPAC name is 2-[4-(2-fluoro-4-methylpentoxy)phenyl]-5-(4-octoxyphenyl)pyrimidine.
| Compound Name | 2-[4-(2-fluoro-4-methylpentoxy)phenyl]-5-(4-octoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 54220564 |
| Molecular Formula | C30H39FN2O2 |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 2-[4-(2-fluoro-4-methylpentoxy)phenyl]-5-(4-octoxyphenyl)pyrimidine |
| SMILES | CCCCCCCCOc1ccc(-c2cnc(-c3ccc(OCC(F)CC(C)C)cc3)nc2)cc1 |
| InChI | InChI=1S/C30H39FN2O2/c1-4-5-6-7-8-9-18-34-28-14-10-24(11-15-28)26-20-32-30(33-21-26)25-12-16-29(17-13-25)35-22-27(31)19-23(2)3/h10-17,20-21,23,27H,4-9,18-19,22H2,1-3H3 |
| InChIKey | QCHGVLPQTCOHHX-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|