C24H34FNO2 — CID 139772028
5-(2-fluoro-4-methylpentoxy)-2-(4-heptoxyphenyl)pyridine (PubChem CID 139772028) has the molecular formula C24H34FNO2 and a molecular weight of 387.54 g/mol. Its IUPAC name is 5-(2-fluoro-4-methylpentoxy)-2-(4-heptoxyphenyl)pyridine.
| Compound Name | 5-(2-fluoro-4-methylpentoxy)-2-(4-heptoxyphenyl)pyridine |
|---|---|
| PubChem CID | 139772028 |
| Molecular Formula | C24H34FNO2 |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 5-(2-fluoro-4-methylpentoxy)-2-(4-heptoxyphenyl)pyridine |
| SMILES | CCCCCCCOc1ccc(-c2ccc(OCC(F)CC(C)C)cn2)cc1 |
| InChI | InChI=1S/C24H34FNO2/c1-4-5-6-7-8-15-27-22-11-9-20(10-12-22)24-14-13-23(17-26-24)28-18-21(25)16-19(2)3/h9-14,17,19,21H,4-8,15-16,18H2,1-3H3 |
| InChIKey | ZGEBPQUIMLEJLX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|