C26H31FN2O2 — CID 22161090
5-[4-(2-fluorobutoxy)phenyl]-2-(4-hexoxyphenyl)pyrimidine (PubChem CID 22161090) has the molecular formula C26H31FN2O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is 5-[4-(2-fluorobutoxy)phenyl]-2-(4-hexoxyphenyl)pyrimidine.
| Compound Name | 5-[4-(2-fluorobutoxy)phenyl]-2-(4-hexoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 22161090 |
| Molecular Formula | C26H31FN2O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 5-[4-(2-fluorobutoxy)phenyl]-2-(4-hexoxyphenyl)pyrimidine |
| SMILES | CCCCCCOc1ccc(-c2ncc(-c3ccc(OCC(F)CC)cc3)cn2)cc1 |
| InChI | InChI=1S/C26H31FN2O2/c1-3-5-6-7-16-30-24-14-10-21(11-15-24)26-28-17-22(18-29-26)20-8-12-25(13-9-20)31-19-23(27)4-2/h8-15,17-18,23H,3-7,16,19H2,1-2H3 |
| InChIKey | YSQATEQJZZWVGD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|