C31H41FN2O2 — CID 54419538
2-[4-(2-fluorononoxy)phenyl]-5-(4-hexoxyphenyl)pyrimidine (PubChem CID 54419538) has the molecular formula C31H41FN2O2 and a molecular weight of 492.68 g/mol. Its IUPAC name is 2-[4-(2-fluorononoxy)phenyl]-5-(4-hexoxyphenyl)pyrimidine.
| Compound Name | 2-[4-(2-fluorononoxy)phenyl]-5-(4-hexoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 54419538 |
| Molecular Formula | C31H41FN2O2 |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | 2-[4-(2-fluorononoxy)phenyl]-5-(4-hexoxyphenyl)pyrimidine |
| SMILES | CCCCCCCC(F)COc1ccc(-c2ncc(-c3ccc(OCCCCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C31H41FN2O2/c1-3-5-7-9-10-12-28(32)24-36-30-19-15-26(16-20-30)31-33-22-27(23-34-31)25-13-17-29(18-14-25)35-21-11-8-6-4-2/h13-20,22-23,28H,3-12,21,24H2,1-2H3 |
| InChIKey | VZUQTMAUTCEDAI-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|