C33H44N2O5 — CID 19866108
1-[4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-pentoxypropanoate (PubChem CID 19866108) has the molecular formula C33H44N2O5 and a molecular weight of 548.72 g/mol. Its IUPAC name is 1-[4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-pentoxypropanoate.
| Compound Name | 1-[4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-pentoxypropanoate |
|---|---|
| PubChem CID | 19866108 |
| Molecular Formula | C33H44N2O5 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | 1-[4-[2-(4-hexoxyphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-pentoxypropanoate |
| SMILES | CCCCCCOc1ccc(-c2ncc(-c3ccc(OCC(C)OC(=O)C(C)OCCCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C33H44N2O5/c1-5-7-9-11-21-38-30-18-14-28(15-19-30)32-34-22-29(23-35-32)27-12-16-31(17-13-27)39-24-25(3)40-33(36)26(4)37-20-10-8-6-2/h12-19,22-23,25-26H,5-11,20-21,24H2,1-4H3 |
| InChIKey | CGBWHMYQOFGRKS-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|