C34H46N2O4 — CID 19866113
1-[4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-pentoxypropanoate (PubChem CID 19866113) has the molecular formula C34H46N2O4 and a molecular weight of 546.75 g/mol. Its IUPAC name is 1-[4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-pentoxypropanoate.
| Compound Name | 1-[4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-pentoxypropanoate |
|---|---|
| PubChem CID | 19866113 |
| Molecular Formula | C34H46N2O4 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 1-[4-[2-(4-heptylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-pentoxypropanoate |
| SMILES | CCCCCCCc1ccc(-c2ncc(-c3ccc(OCC(C)OC(=O)C(C)OCCCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C34H46N2O4/c1-5-7-9-10-11-13-28-14-16-30(17-15-28)33-35-23-31(24-36-33)29-18-20-32(21-19-29)39-25-26(3)40-34(37)27(4)38-22-12-8-6-2/h14-21,23-24,26-27H,5-13,22,25H2,1-4H3 |
| InChIKey | CZMYBUUATLEZNJ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|