C28H34N2O3 — CID 19901434
butyl 2-[4-[5-(4-pentylphenyl)pyrimidin-2-yl]phenoxy]propanoate (PubChem CID 19901434) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is butyl 2-[4-[5-(4-pentylphenyl)pyrimidin-2-yl]phenoxy]propanoate.
| Compound Name | butyl 2-[4-[5-(4-pentylphenyl)pyrimidin-2-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 19901434 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | butyl 2-[4-[5-(4-pentylphenyl)pyrimidin-2-yl]phenoxy]propanoate |
| SMILES | CCCCCc1ccc(-c2cnc(-c3ccc(OC(C)C(=O)OCCCC)cc3)nc2)cc1 |
| InChI | InChI=1S/C28H34N2O3/c1-4-6-8-9-22-10-12-23(13-11-22)25-19-29-27(30-20-25)24-14-16-26(17-15-24)33-21(3)28(31)32-18-7-5-2/h10-17,19-21H,4-9,18H2,1-3H3 |
| InChIKey | KTSBMJOMMRNDSJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|