C30H46N2O3S — CID 70388751
octyl (2R)-2-[4-(2-nonylsulfanylpyrimidin-5-yl)phenoxy]propanoate (PubChem CID 70388751) has the molecular formula C30H46N2O3S and a molecular weight of 514.78 g/mol. Its IUPAC name is octyl (2R)-2-[4-(2-nonylsulfanylpyrimidin-5-yl)phenoxy]propanoate.
| Compound Name | octyl (2R)-2-[4-(2-nonylsulfanylpyrimidin-5-yl)phenoxy]propanoate |
|---|---|
| PubChem CID | 70388751 |
| Molecular Formula | C30H46N2O3S |
| Molecular Weight | 514.78 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | octyl (2R)-2-[4-(2-nonylsulfanylpyrimidin-5-yl)phenoxy]propanoate |
| SMILES | CCCCCCCCCSc1ncc(-c2ccc(O[C@H](C)C(=O)OCCCCCCCC)cc2)cn1 |
| InChI | InChI=1S/C30H46N2O3S/c1-4-6-8-10-12-14-16-22-36-30-31-23-27(24-32-30)26-17-19-28(20-18-26)35-25(3)29(33)34-21-15-13-11-9-7-5-2/h17-20,23-25H,4-16,21-22H2,1-3H3/t25-/m1/s1 |
| InChIKey | QFVYIROUJKELNC-RUZDIDTESA-N |
| XLogP | 8.66 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.78 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|