C23H31ClN2O2S — CID 54454849
[4-(2-heptylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-3-methylpentanoate (PubChem CID 54454849) has the molecular formula C23H31ClN2O2S and a molecular weight of 435.03 g/mol. Its IUPAC name is [4-(2-heptylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-3-methylpentanoate.
| Compound Name | [4-(2-heptylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-3-methylpentanoate |
|---|---|
| PubChem CID | 54454849 |
| Molecular Formula | C23H31ClN2O2S |
| Molecular Weight | 435.03 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [4-(2-heptylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-3-methylpentanoate |
| SMILES | CCCCCCCSc1ncc(-c2ccc(OC(=O)[C@@H](Cl)C(C)CC)cc2)cn1 |
| InChI | InChI=1S/C23H31ClN2O2S/c1-4-6-7-8-9-14-29-23-25-15-19(16-26-23)18-10-12-20(13-11-18)28-22(27)21(24)17(3)5-2/h10-13,15-17,21H,4-9,14H2,1-3H3/t17?,21-/m0/s1 |
| InChIKey | WXLXUCNMLREEIR-LFABVHOISA-N |
| XLogP | 6.76 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.03 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|