C28H40N2O2S — CID 14474668
[4-(2-octylsulfanylpyrimidin-5-yl)phenyl] 2-hexylcyclopropane-1-carboxylate (PubChem CID 14474668) has the molecular formula C28H40N2O2S and a molecular weight of 468.71 g/mol. Its IUPAC name is [4-(2-octylsulfanylpyrimidin-5-yl)phenyl] 2-hexylcyclopropane-1-carboxylate.
| Compound Name | [4-(2-octylsulfanylpyrimidin-5-yl)phenyl] 2-hexylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 14474668 |
| Molecular Formula | C28H40N2O2S |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | [4-(2-octylsulfanylpyrimidin-5-yl)phenyl] 2-hexylcyclopropane-1-carboxylate |
| SMILES | CCCCCCCCSc1ncc(-c2ccc(OC(=O)C3CC3CCCCCC)cc2)cn1 |
| InChI | InChI=1S/C28H40N2O2S/c1-3-5-7-9-10-12-18-33-28-29-20-24(21-30-28)22-14-16-25(17-15-22)32-27(31)26-19-23(26)13-11-8-6-4-2/h14-17,20-21,23,26H,3-13,18-19H2,1-2H3 |
| InChIKey | NDFOKYULPVBDDA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|