About octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate
octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate (PubChem CID 70386865) has the molecular formula C29H42O3S
and a molecular weight of 470.72 g/mol. Its IUPAC name is octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate.
Molecular Properties
| Compound Name | octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate |
| PubChem CID | 70386865 |
| Molecular Formula | C29H42O3S |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate |
| SMILES | CCCCCCCCOC(=O)Oc1ccc(-c2ccc(SCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C29H42O3S/c1-3-5-7-9-11-13-23-31-29(30)32-27-19-15-25(16-20-27)26-17-21-28(22-18-26)33-24-14-12-10-8-6-4-2/h15-22H,3-14,23-24H2,1-2H3 |
| InChIKey | YGZNNBKGDYRVMK-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate?
The IUPAC name of octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate (CID 70386865) is octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate.
What is the SMILES notation for octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate?
The canonical SMILES for octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate is CCCCCCCCOC(=O)Oc1ccc(-c2ccc(SCCCCCCCC)cc2)cc1.
What is the InChIKey of octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate?
The InChIKey is YGZNNBKGDYRVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H42O3S/c1-3-5-7-9-11-13-23-31-29(30)32-27-19-15-25(16-20-27)26-17-21-28(22-18-26)33-24-14-12-10-8-6-4-2/h15-22H,3-14,23-24H2,1-2H3.
What are the key properties of octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate?
octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate has a molecular weight of 470.72 g/mol, XLogP of 9.68, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octyl [4-(4-octylsulfanylphenyl)phenyl] carbonate is sourced from PubChem (CID 70386865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).