C27H37ClO2S — CID 88625404
[4-(4-nonylsulfanylphenyl)phenyl] 2-chloro-3-methylpentanoate (PubChem CID 88625404) has the molecular formula C27H37ClO2S and a molecular weight of 461.11 g/mol. Its IUPAC name is [4-(4-nonylsulfanylphenyl)phenyl] 2-chloro-3-methylpentanoate.
| Compound Name | [4-(4-nonylsulfanylphenyl)phenyl] 2-chloro-3-methylpentanoate |
|---|---|
| PubChem CID | 88625404 |
| Molecular Formula | C27H37ClO2S |
| Molecular Weight | 461.11 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | [4-(4-nonylsulfanylphenyl)phenyl] 2-chloro-3-methylpentanoate |
| SMILES | CCCCCCCCCSc1ccc(-c2ccc(OC(=O)C(Cl)C(C)CC)cc2)cc1 |
| InChI | InChI=1S/C27H37ClO2S/c1-4-6-7-8-9-10-11-20-31-25-18-14-23(15-19-25)22-12-16-24(17-13-22)30-27(29)26(28)21(3)5-2/h12-19,21,26H,4-11,20H2,1-3H3 |
| InChIKey | RHWQHTRYHARLBQ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.11 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|