C29H39ClO3 — CID 100938948
[4-(4-undec-10-enoxyphenyl)phenyl] (2S,3S)-2-chloro-3-methylpentanoate (PubChem CID 100938948) has the molecular formula C29H39ClO3 and a molecular weight of 471.08 g/mol. Its IUPAC name is [4-(4-undec-10-enoxyphenyl)phenyl] (2S,3S)-2-chloro-3-methylpentanoate.
| Compound Name | [4-(4-undec-10-enoxyphenyl)phenyl] (2S,3S)-2-chloro-3-methylpentanoate |
|---|---|
| PubChem CID | 100938948 |
| Molecular Formula | C29H39ClO3 |
| Molecular Weight | 471.08 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | [4-(4-undec-10-enoxyphenyl)phenyl] (2S,3S)-2-chloro-3-methylpentanoate |
| SMILES | C=CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)[C@@H](Cl)[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C29H39ClO3/c1-4-6-7-8-9-10-11-12-13-22-32-26-18-14-24(15-19-26)25-16-20-27(21-17-25)33-29(31)28(30)23(3)5-2/h4,14-21,23,28H,1,5-13,22H2,2-3H3/t23-,28-/m0/s1 |
| InChIKey | MWNYZOWGIBOFGD-FIPFOOKPSA-N |
| XLogP | 8.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.08 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|