About [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate
[4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate (PubChem CID 54381602) has the molecular formula C24H31ClO3
and a molecular weight of 402.96 g/mol. Its IUPAC name is [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate.
Molecular Properties
| Compound Name | [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate |
| PubChem CID | 54381602 |
| Molecular Formula | C24H31ClO3 |
| Molecular Weight | 402.96 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc(OC(=O)[C@@H](C)Cl)cc2)cc1 |
| InChI | InChI=1S/C24H31ClO3/c1-3-4-5-6-7-8-9-18-27-22-14-10-20(11-15-22)21-12-16-23(17-13-21)28-24(26)19(2)25/h10-17,19H,3-9,18H2,1-2H3/t19-/m1/s1 |
| InChIKey | VAHNJIKRPZFGFB-LJQANCHMSA-N |
| XLogP | 7.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.96 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate?
The IUPAC name of [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate (CID 54381602) is [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate.
What is the SMILES notation for [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate?
The canonical SMILES for [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate is CCCCCCCCCOc1ccc(-c2ccc(OC(=O)[C@@H](C)Cl)cc2)cc1.
What is the InChIKey of [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate?
The InChIKey is VAHNJIKRPZFGFB-LJQANCHMSA-N. The full InChI is InChI=1S/C24H31ClO3/c1-3-4-5-6-7-8-9-18-27-22-14-10-20(11-15-22)21-12-16-23(17-13-21)28-24(26)19(2)25/h10-17,19H,3-9,18H2,1-2H3/t19-/m1/s1.
What are the key properties of [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate?
[4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate has a molecular weight of 402.96 g/mol, XLogP of 7.02, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-nonoxyphenyl)phenyl] (2R)-2-chloropropanoate is sourced from PubChem (CID 54381602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).