C23H30O4 — CID 71341870
2-[4-(4-octoxyphenyl)phenoxy]propanoic acid (PubChem CID 71341870) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[4-(4-octoxyphenyl)phenoxy]propanoic acid.
| Compound Name | 2-[4-(4-octoxyphenyl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 71341870 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[4-(4-octoxyphenyl)phenoxy]propanoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H30O4/c1-3-4-5-6-7-8-17-26-21-13-9-19(10-14-21)20-11-15-22(16-12-20)27-18(2)23(24)25/h9-16,18H,3-8,17H2,1-2H3,(H,24,25) |
| InChIKey | SEGGCDPYGIORIA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|