C27H35ClO5 — CID 22837086
[4-(4-octoxycarbonyloxyphenyl)phenyl] (2R,3S)-2-chloro-3-methylpentanoate (PubChem CID 22837086) has the molecular formula C27H35ClO5 and a molecular weight of 475.03 g/mol. Its IUPAC name is [4-(4-octoxycarbonyloxyphenyl)phenyl] (2R,3S)-2-chloro-3-methylpentanoate.
| Compound Name | [4-(4-octoxycarbonyloxyphenyl)phenyl] (2R,3S)-2-chloro-3-methylpentanoate |
|---|---|
| PubChem CID | 22837086 |
| Molecular Formula | C27H35ClO5 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [4-(4-octoxycarbonyloxyphenyl)phenyl] (2R,3S)-2-chloro-3-methylpentanoate |
| SMILES | CCCCCCCCOC(=O)Oc1ccc(-c2ccc(OC(=O)[C@H](Cl)[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C27H35ClO5/c1-4-6-7-8-9-10-19-31-27(30)33-24-17-13-22(14-18-24)21-11-15-23(16-12-21)32-26(29)25(28)20(3)5-2/h11-18,20,25H,4-10,19H2,1-3H3/t20-,25+/m0/s1 |
| InChIKey | XXVWNQJECZGGDD-NBGIEHNGSA-N |
| XLogP | 7.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|