C26H33ClF2O3 — CID 22960043
[2,3-difluoro-4-(4-octoxyphenyl)phenyl] 2-chloro-3-methylpentanoate (PubChem CID 22960043) has the molecular formula C26H33ClF2O3 and a molecular weight of 467.00 g/mol. Its IUPAC name is [2,3-difluoro-4-(4-octoxyphenyl)phenyl] 2-chloro-3-methylpentanoate.
| Compound Name | [2,3-difluoro-4-(4-octoxyphenyl)phenyl] 2-chloro-3-methylpentanoate |
|---|---|
| PubChem CID | 22960043 |
| Molecular Formula | C26H33ClF2O3 |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [2,3-difluoro-4-(4-octoxyphenyl)phenyl] 2-chloro-3-methylpentanoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)C(Cl)C(C)CC)c(F)c2F)cc1 |
| InChI | InChI=1S/C26H33ClF2O3/c1-4-6-7-8-9-10-17-31-20-13-11-19(12-14-20)21-15-16-22(25(29)24(21)28)32-26(30)23(27)18(3)5-2/h11-16,18,23H,4-10,17H2,1-3H3 |
| InChIKey | NXSNOWRBKXSXDH-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|