C31H34F2O6 — CID 14512171
[4-(1-ethoxy-1-oxopropan-2-yl)oxy-2,3-difluorophenyl] 4-(4-heptoxyphenyl)benzoate (PubChem CID 14512171) has the molecular formula C31H34F2O6 and a molecular weight of 540.60 g/mol. Its IUPAC name is [4-(1-ethoxy-1-oxopropan-2-yl)oxy-2,3-difluorophenyl] 4-(4-heptoxyphenyl)benzoate.
| Compound Name | [4-(1-ethoxy-1-oxopropan-2-yl)oxy-2,3-difluorophenyl] 4-(4-heptoxyphenyl)benzoate |
|---|---|
| PubChem CID | 14512171 |
| Molecular Formula | C31H34F2O6 |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [4-(1-ethoxy-1-oxopropan-2-yl)oxy-2,3-difluorophenyl] 4-(4-heptoxyphenyl)benzoate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OC(C)C(=O)OCC)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C31H34F2O6/c1-4-6-7-8-9-20-37-25-16-14-23(15-17-25)22-10-12-24(13-11-22)31(35)39-27-19-18-26(28(32)29(27)33)38-21(3)30(34)36-5-2/h10-19,21H,4-9,20H2,1-3H3 |
| InChIKey | FRYXIJFSLVCQPW-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|