C28H39ClO3 — CID 139882299
[4-(4-hexoxyphenyl)phenyl] 2-chloro-3,7-dimethyloctanoate (PubChem CID 139882299) has the molecular formula C28H39ClO3 and a molecular weight of 459.07 g/mol. Its IUPAC name is [4-(4-hexoxyphenyl)phenyl] 2-chloro-3,7-dimethyloctanoate.
| Compound Name | [4-(4-hexoxyphenyl)phenyl] 2-chloro-3,7-dimethyloctanoate |
|---|---|
| PubChem CID | 139882299 |
| Molecular Formula | C28H39ClO3 |
| Molecular Weight | 459.07 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | [4-(4-hexoxyphenyl)phenyl] 2-chloro-3,7-dimethyloctanoate |
| SMILES | CCCCCCOc1ccc(-c2ccc(OC(=O)C(Cl)C(C)CCCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H39ClO3/c1-5-6-7-8-20-31-25-16-12-23(13-17-25)24-14-18-26(19-15-24)32-28(30)27(29)22(4)11-9-10-21(2)3/h12-19,21-22,27H,5-11,20H2,1-4H3 |
| InChIKey | GBVKYBWANXZXGY-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.07 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|